C23H21FN4O6 — CID 54748816
6-[(4-fluorophenyl)methyl]-10-hydroxy-11-N-(2-methoxyethyl)-3-N-methyl-12-oxo-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-2,5(13),6,8,10-pentaene-3,11-dicarboxamide (PubChem CID 54748816) has the molecular formula C23H21FN4O6 and a molecular weight of 468.44 g/mol. Its IUPAC name is 6-[(4-fluorophenyl)methyl]-10-hydroxy-11-N-(2-methoxyethyl)-3-N-methyl-12-oxo-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-2,5(13),6,8,10-pentaene-3,11-dicarboxamide.
| Compound Name | 6-[(4-fluorophenyl)methyl]-10-hydroxy-11-N-(2-methoxyethyl)-3-N-methyl-12-oxo-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-2,5(13),6,8,10-pentaene-3,11-dicarboxamide |
|---|---|
| PubChem CID | 54748816 |
| Molecular Formula | C23H21FN4O6 |
| Molecular Weight | 468.44 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | 6-[(4-fluorophenyl)methyl]-10-hydroxy-11-N-(2-methoxyethyl)-3-N-methyl-12-oxo-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-2,5(13),6,8,10-pentaene-3,11-dicarboxamide |
| SMILES | CNC(=O)C1=Cn2c(=O)c(C(=O)NCCOC)c(O)c3ncc(Cc4ccc(F)cc4)c(c32)O1 |
| InChI | InChI=1S/C23H21FN4O6/c1-25-21(30)15-11-28-18-17(19(29)16(23(28)32)22(31)26-7-8-33-2)27-10-13(20(18)34-15)9-12-3-5-14(24)6-4-12/h3-6,10-11,29H,7-9H2,1-2H3,(H,25,30)(H,26,31) |
| InChIKey | TVRNARUQPWYFDK-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 131.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.44 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|