C27H25FN4O4 — CID 54748850
6-[(4-fluorophenyl)methyl]-10-hydroxy-12-oxo-N-(2-phenylmethoxyethyl)-1,4,8-triazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-11-carboxamide (PubChem CID 54748850) has the molecular formula C27H25FN4O4 and a molecular weight of 488.52 g/mol. Its IUPAC name is 6-[(4-fluorophenyl)methyl]-10-hydroxy-12-oxo-N-(2-phenylmethoxyethyl)-1,4,8-triazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-11-carboxamide.
| Compound Name | 6-[(4-fluorophenyl)methyl]-10-hydroxy-12-oxo-N-(2-phenylmethoxyethyl)-1,4,8-triazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-11-carboxamide |
|---|---|
| PubChem CID | 54748850 |
| Molecular Formula | C27H25FN4O4 |
| Molecular Weight | 488.52 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | 6-[(4-fluorophenyl)methyl]-10-hydroxy-12-oxo-N-(2-phenylmethoxyethyl)-1,4,8-triazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-11-carboxamide |
| SMILES | O=C(NCCOCc1ccccc1)c1c(O)c2ncc(Cc3ccc(F)cc3)c3c2n(c1=O)CCN3 |
| InChI | InChI=1S/C27H25FN4O4/c28-20-8-6-17(7-9-20)14-19-15-31-23-24-22(19)29-10-12-32(24)27(35)21(25(23)33)26(34)30-11-13-36-16-18-4-2-1-3-5-18/h1-9,15,29,33H,10-14,16H2,(H,30,34) |
| InChIKey | BZOCTXGUMJZSFF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.52 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|