About [(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl] N-ethylcarbamate
[(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl] N-ethylcarbamate (PubChem CID 54749012) has the molecular formula C9H13NO7
and a molecular weight of 247.20 g/mol. Its IUPAC name is [(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl] N-ethylcarbamate.
Molecular Properties
| Compound Name | [(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl] N-ethylcarbamate |
| PubChem CID | 54749012 |
| Molecular Formula | C9H13NO7 |
| Molecular Weight | 247.20 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | [(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl] N-ethylcarbamate |
| SMILES | CCNC(=O)OC1=C(O)[C@@H]([C@@H](O)CO)OC1=O |
| InChI | InChI=1S/C9H13NO7/c1-2-10-9(15)17-7-5(13)6(4(12)3-11)16-8(7)14/h4,6,11-13H,2-3H2,1H3,(H,10,15)/t4-,6+/m0/s1 |
| InChIKey | YXQDLRPLNOARID-UJURSFKZSA-N |
| XLogP | -1.22 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.20 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl] N-ethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl] N-ethylcarbamate?
The IUPAC name of [(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl] N-ethylcarbamate (CID 54749012) is [(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl] N-ethylcarbamate.
What is the SMILES notation for [(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl] N-ethylcarbamate?
The canonical SMILES for [(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl] N-ethylcarbamate is CCNC(=O)OC1=C(O)[C@@H]([C@@H](O)CO)OC1=O.
What is the InChIKey of [(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl] N-ethylcarbamate?
The InChIKey is YXQDLRPLNOARID-UJURSFKZSA-N. The full InChI is InChI=1S/C9H13NO7/c1-2-10-9(15)17-7-5(13)6(4(12)3-11)16-8(7)14/h4,6,11-13H,2-3H2,1H3,(H,10,15)/t4-,6+/m0/s1.
What are the key properties of [(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl] N-ethylcarbamate?
[(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl] N-ethylcarbamate has a molecular weight of 247.20 g/mol, XLogP of -1.22, 4 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl] N-ethylcarbamate is sourced from PubChem (CID 54749012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).