About ethyl 2-[[(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]propanoate
ethyl 2-[[(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]propanoate (PubChem CID 54749014) has the molecular formula C12H17NO9
and a molecular weight of 319.27 g/mol. Its IUPAC name is ethyl 2-[[(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]propanoate.
Molecular Properties
| Compound Name | ethyl 2-[[(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]propanoate |
| PubChem CID | 54749014 |
| Molecular Formula | C12H17NO9 |
| Molecular Weight | 319.27 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | ethyl 2-[[(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]propanoate |
| SMILES | CCOC(=O)C(C)NC(=O)OC1=C(O)[C@@H]([C@@H](O)CO)OC1=O |
| InChI | InChI=1S/C12H17NO9/c1-3-20-10(17)5(2)13-12(19)22-9-7(16)8(6(15)4-14)21-11(9)18/h5-6,8,14-16H,3-4H2,1-2H3,(H,13,19)/t5?,6-,8+/m0/s1 |
| InChIKey | VQBXJOVGWKCQHT-KVWYPCGYSA-N |
| XLogP | -1.29 |
| TPSA | 151.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.27 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[[(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[[(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]propanoate?
The IUPAC name of ethyl 2-[[(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]propanoate (CID 54749014) is ethyl 2-[[(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]propanoate.
What is the SMILES notation for ethyl 2-[[(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]propanoate?
The canonical SMILES for ethyl 2-[[(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]propanoate is CCOC(=O)C(C)NC(=O)OC1=C(O)[C@@H]([C@@H](O)CO)OC1=O.
What is the InChIKey of ethyl 2-[[(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]propanoate?
The InChIKey is VQBXJOVGWKCQHT-KVWYPCGYSA-N. The full InChI is InChI=1S/C12H17NO9/c1-3-20-10(17)5(2)13-12(19)22-9-7(16)8(6(15)4-14)21-11(9)18/h5-6,8,14-16H,3-4H2,1-2H3,(H,13,19)/t5?,6-,8+/m0/s1.
What are the key properties of ethyl 2-[[(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]propanoate?
ethyl 2-[[(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]propanoate has a molecular weight of 319.27 g/mol, XLogP of -1.29, 6 rotatable bonds, 4 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[[(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-hydroxy-5-oxo-2H-furan-4-yl]oxycarbonylamino]propanoate is sourced from PubChem (CID 54749014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).