C17H24O4 — CID 54749148
4-hydroxy-6-[(1E,3Z,5S,6R)-6-hydroxy-3,5-dimethylocta-1,3-dienyl]-3,5-dimethylpyran-2-one (PubChem CID 54749148) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is 4-hydroxy-6-[(1E,3Z,5S,6R)-6-hydroxy-3,5-dimethylocta-1,3-dienyl]-3,5-dimethylpyran-2-one.
| Compound Name | 4-hydroxy-6-[(1E,3Z,5S,6R)-6-hydroxy-3,5-dimethylocta-1,3-dienyl]-3,5-dimethylpyran-2-one |
|---|---|
| PubChem CID | 54749148 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 4-hydroxy-6-[(1E,3Z,5S,6R)-6-hydroxy-3,5-dimethylocta-1,3-dienyl]-3,5-dimethylpyran-2-one |
| SMILES | CC[C@@H](O)[C@@H](C)/C=C(C)\C=C\c1oc(=O)c(C)c(O)c1C |
| InChI | InChI=1S/C17H24O4/c1-6-14(18)11(3)9-10(2)7-8-15-12(4)16(19)13(5)17(20)21-15/h7-9,11,14,18-19H,6H2,1-5H3/b8-7+,10-9-/t11-,14+/m0/s1 |
| InChIKey | ZAMAVOUZTQYUMR-IPBYJVNYSA-N |
| XLogP | 3.33 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|