C37H58O9S — CID 5474979
2-(1,2-dicarboxyethylsulfanyl)butanedioic acid;17-[(E)-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 5474979) has the molecular formula C37H58O9S and a molecular weight of 678.93 g/mol. Its IUPAC name is 2-(1,2-dicarboxyethylsulfanyl)butanedioic acid;17-[(E)-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | 2-(1,2-dicarboxyethylsulfanyl)butanedioic acid;17-[(E)-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 5474979 |
| Molecular Formula | C37H58O9S |
| Molecular Weight | 678.93 g/mol |
| Exact Mass | 678.38 |
| IUPAC Name | 2-(1,2-dicarboxyethylsulfanyl)butanedioic acid;17-[(E)-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CCC(/C=C/C(C)C1CCC2C3CC=C4CC(O)CCC4(C)C3CCC12C)C(C)C.O=C(O)CC(SC(CC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C29H48O.C8H10O8S/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6;9-5(10)1-3(7(13)14)17-4(8(15)16)2-6(11)12/h8-10,19-21,23-27,30H,7,11-18H2,1-6H3;3-4H,1-2H2,(H,9,10)(H,11,12)(H,13,14)(H,15,16)/b9-8+; |
| InChIKey | NAHHDAOJYFEFQO-HRNDJLQDSA-N |
| XLogP | 7.38 |
| TPSA | 169.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.93 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|