C8H9O4- — CID 54750357
(2E,4Z)-1-hydroxy-3-methyl-1,6-dioxohepta-2,4-dien-2-olate (PubChem CID 54750357) has the molecular formula C8H9O4- and a molecular weight of 169.16 g/mol. Its IUPAC name is (2E,4Z)-1-hydroxy-3-methyl-1,6-dioxohepta-2,4-dien-2-olate.
| Compound Name | (2E,4Z)-1-hydroxy-3-methyl-1,6-dioxohepta-2,4-dien-2-olate |
|---|---|
| PubChem CID | 54750357 |
| Molecular Formula | C8H9O4- |
| Molecular Weight | 169.16 g/mol |
| Exact Mass | 169.05 |
| IUPAC Name | (2E,4Z)-1-hydroxy-3-methyl-1,6-dioxohepta-2,4-dien-2-olate |
| SMILES | CC(=O)/C=C\C(C)=C(\[O-])C(=O)O |
| InChI | InChI=1S/C8H10O4/c1-5(3-4-6(2)9)7(10)8(11)12/h3-4,10H,1-2H3,(H,11,12)/p-1/b4-3-,7-5+ |
| InChIKey | KMEHUECHDKPAIO-QVXLNCAUSA-M |
| XLogP | -0.15 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.16 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|