About copper;bis((6Z)-6-[(6-hydroxyhexylamino)methylidene]cyclohexa-2,4-dien-1-one)
copper;bis((6Z)-6-[(6-hydroxyhexylamino)methylidene]cyclohexa-2,4-dien-1-one) (PubChem CID 5475131) has the molecular formula C26H38CuN2O4
and a molecular weight of 506.15 g/mol. Its IUPAC name is copper;bis((6Z)-6-[(6-hydroxyhexylamino)methylidene]cyclohexa-2,4-dien-1-one).
Molecular Properties
| Compound Name | copper;bis((6Z)-6-[(6-hydroxyhexylamino)methylidene]cyclohexa-2,4-dien-1-one) |
| PubChem CID | 5475131 |
| Molecular Formula | C26H38CuN2O4 |
| Molecular Weight | 506.15 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | copper;bis((6Z)-6-[(6-hydroxyhexylamino)methylidene]cyclohexa-2,4-dien-1-one) |
| SMILES | O=C1C=CC=C/C1=C/NCCCCCCO.O=C1C=CC=C/C1=C/NCCCCCCO.[Cu] |
| InChI | InChI=1S/2C13H19NO2.Cu/c2*15-10-6-2-1-5-9-14-11-12-7-3-4-8-13(12)16;/h2*3-4,7-8,11,14-15H,1-2,5-6,9-10H2;/b2*12-11-; |
| InChIKey | AEFGZCYQCWBUGQ-ZELJJWTBSA-N |
| XLogP | 3.41 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 506.15 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze copper;bis((6Z)-6-[(6-hydroxyhexylamino)methylidene]cyclohexa-2,4-dien-1-one) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;bis((6Z)-6-[(6-hydroxyhexylamino)methylidene]cyclohexa-2,4-dien-1-one)?
The IUPAC name of copper;bis((6Z)-6-[(6-hydroxyhexylamino)methylidene]cyclohexa-2,4-dien-1-one) (CID 5475131) is copper;bis((6Z)-6-[(6-hydroxyhexylamino)methylidene]cyclohexa-2,4-dien-1-one).
What is the SMILES notation for copper;bis((6Z)-6-[(6-hydroxyhexylamino)methylidene]cyclohexa-2,4-dien-1-one)?
The canonical SMILES for copper;bis((6Z)-6-[(6-hydroxyhexylamino)methylidene]cyclohexa-2,4-dien-1-one) is O=C1C=CC=C/C1=C/NCCCCCCO.O=C1C=CC=C/C1=C/NCCCCCCO.[Cu].
What is the InChIKey of copper;bis((6Z)-6-[(6-hydroxyhexylamino)methylidene]cyclohexa-2,4-dien-1-one)?
The InChIKey is AEFGZCYQCWBUGQ-ZELJJWTBSA-N. The full InChI is InChI=1S/2C13H19NO2.Cu/c2*15-10-6-2-1-5-9-14-11-12-7-3-4-8-13(12)16;/h2*3-4,7-8,11,14-15H,1-2,5-6,9-10H2;/b2*12-11-;.
What are the key properties of copper;bis((6Z)-6-[(6-hydroxyhexylamino)methylidene]cyclohexa-2,4-dien-1-one)?
copper;bis((6Z)-6-[(6-hydroxyhexylamino)methylidene]cyclohexa-2,4-dien-1-one) has a molecular weight of 506.15 g/mol, XLogP of 3.41, 14 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for copper;bis((6Z)-6-[(6-hydroxyhexylamino)methylidene]cyclohexa-2,4-dien-1-one) is sourced from PubChem (CID 5475131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).