About bis((6Z)-6-[(2-hydroxyethylamino)methylidene]cyclohexa-2,4-dien-1-one);nickel
bis((6Z)-6-[(2-hydroxyethylamino)methylidene]cyclohexa-2,4-dien-1-one);nickel (PubChem CID 5475143) has the molecular formula C18H22N2NiO4
and a molecular weight of 389.08 g/mol. Its IUPAC name is bis((6Z)-6-[(2-hydroxyethylamino)methylidene]cyclohexa-2,4-dien-1-one);nickel.
Molecular Properties
| Compound Name | bis((6Z)-6-[(2-hydroxyethylamino)methylidene]cyclohexa-2,4-dien-1-one);nickel |
| PubChem CID | 5475143 |
| Molecular Formula | C18H22N2NiO4 |
| Molecular Weight | 389.08 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | bis((6Z)-6-[(2-hydroxyethylamino)methylidene]cyclohexa-2,4-dien-1-one);nickel |
| SMILES | O=C1C=CC=C/C1=C/NCCO.O=C1C=CC=C/C1=C/NCCO.[Ni] |
| InChI | InChI=1S/2C9H11NO2.Ni/c2*11-6-5-10-7-8-3-1-2-4-9(8)12;/h2*1-4,7,10-11H,5-6H2;/b2*8-7-; |
| InChIKey | QVPVYJWHUGWMJQ-ATMONBRVSA-N |
| XLogP | 0.29 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.08 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis((6Z)-6-[(2-hydroxyethylamino)methylidene]cyclohexa-2,4-dien-1-one);nickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((6Z)-6-[(2-hydroxyethylamino)methylidene]cyclohexa-2,4-dien-1-one);nickel?
The IUPAC name of bis((6Z)-6-[(2-hydroxyethylamino)methylidene]cyclohexa-2,4-dien-1-one);nickel (CID 5475143) is bis((6Z)-6-[(2-hydroxyethylamino)methylidene]cyclohexa-2,4-dien-1-one);nickel.
What is the SMILES notation for bis((6Z)-6-[(2-hydroxyethylamino)methylidene]cyclohexa-2,4-dien-1-one);nickel?
The canonical SMILES for bis((6Z)-6-[(2-hydroxyethylamino)methylidene]cyclohexa-2,4-dien-1-one);nickel is O=C1C=CC=C/C1=C/NCCO.O=C1C=CC=C/C1=C/NCCO.[Ni].
What is the InChIKey of bis((6Z)-6-[(2-hydroxyethylamino)methylidene]cyclohexa-2,4-dien-1-one);nickel?
The InChIKey is QVPVYJWHUGWMJQ-ATMONBRVSA-N. The full InChI is InChI=1S/2C9H11NO2.Ni/c2*11-6-5-10-7-8-3-1-2-4-9(8)12;/h2*1-4,7,10-11H,5-6H2;/b2*8-7-;.
What are the key properties of bis((6Z)-6-[(2-hydroxyethylamino)methylidene]cyclohexa-2,4-dien-1-one);nickel?
bis((6Z)-6-[(2-hydroxyethylamino)methylidene]cyclohexa-2,4-dien-1-one);nickel has a molecular weight of 389.08 g/mol, XLogP of 0.29, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis((6Z)-6-[(2-hydroxyethylamino)methylidene]cyclohexa-2,4-dien-1-one);nickel is sourced from PubChem (CID 5475143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).