About bis((6Z)-6-[(3-hydroxypropylamino)methylidene]cyclohexa-2,4-dien-1-one);nickel
bis((6Z)-6-[(3-hydroxypropylamino)methylidene]cyclohexa-2,4-dien-1-one);nickel (PubChem CID 5475144) has the molecular formula C20H26N2NiO4
and a molecular weight of 417.13 g/mol. Its IUPAC name is bis((6Z)-6-[(3-hydroxypropylamino)methylidene]cyclohexa-2,4-dien-1-one);nickel.
Molecular Properties
| Compound Name | bis((6Z)-6-[(3-hydroxypropylamino)methylidene]cyclohexa-2,4-dien-1-one);nickel |
| PubChem CID | 5475144 |
| Molecular Formula | C20H26N2NiO4 |
| Molecular Weight | 417.13 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | bis((6Z)-6-[(3-hydroxypropylamino)methylidene]cyclohexa-2,4-dien-1-one);nickel |
| SMILES | O=C1C=CC=C/C1=C/NCCCO.O=C1C=CC=C/C1=C/NCCCO.[Ni] |
| InChI | InChI=1S/2C10H13NO2.Ni/c2*12-7-3-6-11-8-9-4-1-2-5-10(9)13;/h2*1-2,4-5,8,11-12H,3,6-7H2;/b2*9-8-; |
| InChIKey | ZOLRHYCBNKNZGC-YJMDFNLSSA-N |
| XLogP | 1.07 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.13 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis((6Z)-6-[(3-hydroxypropylamino)methylidene]cyclohexa-2,4-dien-1-one);nickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((6Z)-6-[(3-hydroxypropylamino)methylidene]cyclohexa-2,4-dien-1-one);nickel?
The IUPAC name of bis((6Z)-6-[(3-hydroxypropylamino)methylidene]cyclohexa-2,4-dien-1-one);nickel (CID 5475144) is bis((6Z)-6-[(3-hydroxypropylamino)methylidene]cyclohexa-2,4-dien-1-one);nickel.
What is the SMILES notation for bis((6Z)-6-[(3-hydroxypropylamino)methylidene]cyclohexa-2,4-dien-1-one);nickel?
The canonical SMILES for bis((6Z)-6-[(3-hydroxypropylamino)methylidene]cyclohexa-2,4-dien-1-one);nickel is O=C1C=CC=C/C1=C/NCCCO.O=C1C=CC=C/C1=C/NCCCO.[Ni].
What is the InChIKey of bis((6Z)-6-[(3-hydroxypropylamino)methylidene]cyclohexa-2,4-dien-1-one);nickel?
The InChIKey is ZOLRHYCBNKNZGC-YJMDFNLSSA-N. The full InChI is InChI=1S/2C10H13NO2.Ni/c2*12-7-3-6-11-8-9-4-1-2-5-10(9)13;/h2*1-2,4-5,8,11-12H,3,6-7H2;/b2*9-8-;.
What are the key properties of bis((6Z)-6-[(3-hydroxypropylamino)methylidene]cyclohexa-2,4-dien-1-one);nickel?
bis((6Z)-6-[(3-hydroxypropylamino)methylidene]cyclohexa-2,4-dien-1-one);nickel has a molecular weight of 417.13 g/mol, XLogP of 1.07, 8 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis((6Z)-6-[(3-hydroxypropylamino)methylidene]cyclohexa-2,4-dien-1-one);nickel is sourced from PubChem (CID 5475144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).