C23H17ClN5O2S+ — CID 54751672
N-[2-[(5-chloro-1H-indole-2-carbonyl)amino]phenyl]-5-methyl-[1,3]thiazolo[5,4-c]pyridin-5-ium-2-carboxamide (PubChem CID 54751672) has the molecular formula C23H17ClN5O2S+ and a molecular weight of 462.94 g/mol. Its IUPAC name is N-[2-[(5-chloro-1H-indole-2-carbonyl)amino]phenyl]-5-methyl-[1,3]thiazolo[5,4-c]pyridin-5-ium-2-carboxamide.
| Compound Name | N-[2-[(5-chloro-1H-indole-2-carbonyl)amino]phenyl]-5-methyl-[1,3]thiazolo[5,4-c]pyridin-5-ium-2-carboxamide |
|---|---|
| PubChem CID | 54751672 |
| Molecular Formula | C23H17ClN5O2S+ |
| Molecular Weight | 462.94 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | N-[2-[(5-chloro-1H-indole-2-carbonyl)amino]phenyl]-5-methyl-[1,3]thiazolo[5,4-c]pyridin-5-ium-2-carboxamide |
| SMILES | C[n+]1ccc2nc(C(=O)Nc3ccccc3NC(=O)c3cc4cc(Cl)ccc4[nH]3)sc2c1 |
| InChI | InChI=1S/C23H16ClN5O2S/c1-29-9-8-18-20(12-29)32-23(28-18)22(31)27-17-5-3-2-4-16(17)26-21(30)19-11-13-10-14(24)6-7-15(13)25-19/h2-12H,1H3,(H2,25,30,31)/p+1 |
| InChIKey | RLRGQYKXKCYSGH-UHFFFAOYSA-O |
| XLogP | 4.76 |
| TPSA | 90.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.94 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|