About 3-[(3,4-dichlorophenyl)methylsulfanyl]-N-methylsulfonylthiophene-2-carboxamide
3-[(3,4-dichlorophenyl)methylsulfanyl]-N-methylsulfonylthiophene-2-carboxamide (PubChem CID 54751676) has the molecular formula C13H11Cl2NO3S3
and a molecular weight of 396.34 g/mol. Its IUPAC name is 3-[(3,4-dichlorophenyl)methylsulfanyl]-N-methylsulfonylthiophene-2-carboxamide.
Molecular Properties
| Compound Name | 3-[(3,4-dichlorophenyl)methylsulfanyl]-N-methylsulfonylthiophene-2-carboxamide |
| PubChem CID | 54751676 |
| Molecular Formula | C13H11Cl2NO3S3 |
| Molecular Weight | 396.34 g/mol |
| Exact Mass | 394.93 |
| IUPAC Name | 3-[(3,4-dichlorophenyl)methylsulfanyl]-N-methylsulfonylthiophene-2-carboxamide |
| SMILES | CS(=O)(=O)NC(=O)c1sccc1SCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H11Cl2NO3S3/c1-22(18,19)16-13(17)12-11(4-5-20-12)21-7-8-2-3-9(14)10(15)6-8/h2-6H,7H2,1H3,(H,16,17) |
| InChIKey | WUCGCEYWGIIVMD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.34 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(3,4-dichlorophenyl)methylsulfanyl]-N-methylsulfonylthiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3,4-dichlorophenyl)methylsulfanyl]-N-methylsulfonylthiophene-2-carboxamide?
The IUPAC name of 3-[(3,4-dichlorophenyl)methylsulfanyl]-N-methylsulfonylthiophene-2-carboxamide (CID 54751676) is 3-[(3,4-dichlorophenyl)methylsulfanyl]-N-methylsulfonylthiophene-2-carboxamide.
What is the SMILES notation for 3-[(3,4-dichlorophenyl)methylsulfanyl]-N-methylsulfonylthiophene-2-carboxamide?
The canonical SMILES for 3-[(3,4-dichlorophenyl)methylsulfanyl]-N-methylsulfonylthiophene-2-carboxamide is CS(=O)(=O)NC(=O)c1sccc1SCc1ccc(Cl)c(Cl)c1.
What is the InChIKey of 3-[(3,4-dichlorophenyl)methylsulfanyl]-N-methylsulfonylthiophene-2-carboxamide?
The InChIKey is WUCGCEYWGIIVMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11Cl2NO3S3/c1-22(18,19)16-13(17)12-11(4-5-20-12)21-7-8-2-3-9(14)10(15)6-8/h2-6H,7H2,1H3,(H,16,17).
What are the key properties of 3-[(3,4-dichlorophenyl)methylsulfanyl]-N-methylsulfonylthiophene-2-carboxamide?
3-[(3,4-dichlorophenyl)methylsulfanyl]-N-methylsulfonylthiophene-2-carboxamide has a molecular weight of 396.34 g/mol, XLogP of 4.04, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,4-dichlorophenyl)methylsulfanyl]-N-methylsulfonylthiophene-2-carboxamide is sourced from PubChem (CID 54751676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).