C9H11NO2 — CID 54751722
1-hydroxy-5,6,7,8-tetrahydro-2H-isoquinolin-3-one (PubChem CID 54751722) has the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. Its IUPAC name is 1-hydroxy-5,6,7,8-tetrahydro-2H-isoquinolin-3-one.
| Compound Name | 1-hydroxy-5,6,7,8-tetrahydro-2H-isoquinolin-3-one |
|---|---|
| PubChem CID | 54751722 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 1-hydroxy-5,6,7,8-tetrahydro-2H-isoquinolin-3-one |
| SMILES | O=c1cc2c(c(O)[nH]1)CCCC2 |
| InChI | InChI=1S/C9H11NO2/c11-8-5-6-3-1-2-4-7(6)9(12)10-8/h5H,1-4H2,(H2,10,11,12) |
| InChIKey | KIBWBJZQFURZIF-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |