C21H21NO5 — CID 54752084
methyl (2R,3S,4aS)-3-(4-methoxyphenyl)-1-oxo-3,4,4a,6-tetrahydro-2H-pyrido[1,2-a][3,1]benzoxazine-2-carboxylate (PubChem CID 54752084) has the molecular formula C21H21NO5 and a molecular weight of 367.40 g/mol. Its IUPAC name is methyl (2R,3S,4aS)-3-(4-methoxyphenyl)-1-oxo-3,4,4a,6-tetrahydro-2H-pyrido[1,2-a][3,1]benzoxazine-2-carboxylate.
| Compound Name | methyl (2R,3S,4aS)-3-(4-methoxyphenyl)-1-oxo-3,4,4a,6-tetrahydro-2H-pyrido[1,2-a][3,1]benzoxazine-2-carboxylate |
|---|---|
| PubChem CID | 54752084 |
| Molecular Formula | C21H21NO5 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | methyl (2R,3S,4aS)-3-(4-methoxyphenyl)-1-oxo-3,4,4a,6-tetrahydro-2H-pyrido[1,2-a][3,1]benzoxazine-2-carboxylate |
| SMILES | COC(=O)[C@H]1C(=O)N2c3ccccc3CO[C@H]2C[C@@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C21H21NO5/c1-25-15-9-7-13(8-10-15)16-11-18-22(20(23)19(16)21(24)26-2)17-6-4-3-5-14(17)12-27-18/h3-10,16,18-19H,11-12H2,1-2H3/t16-,18+,19-/m1/s1 |
| InChIKey | RATOSMCHMJWVBT-NZSAHSFTSA-N |
| XLogP | 2.86 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|