C14H23N3O6S3 — CID 54752132
N-ethyl-N-[(4R)-2-(3-methoxypropyl)-1,1-dioxo-6-sulfamoyl-3,4-dihydrothieno[3,2-e]thiazin-4-yl]acetamide (PubChem CID 54752132) has the molecular formula C14H23N3O6S3 and a molecular weight of 425.55 g/mol. Its IUPAC name is N-ethyl-N-[(4R)-2-(3-methoxypropyl)-1,1-dioxo-6-sulfamoyl-3,4-dihydrothieno[3,2-e]thiazin-4-yl]acetamide.
| Compound Name | N-ethyl-N-[(4R)-2-(3-methoxypropyl)-1,1-dioxo-6-sulfamoyl-3,4-dihydrothieno[3,2-e]thiazin-4-yl]acetamide |
|---|---|
| PubChem CID | 54752132 |
| Molecular Formula | C14H23N3O6S3 |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | N-ethyl-N-[(4R)-2-(3-methoxypropyl)-1,1-dioxo-6-sulfamoyl-3,4-dihydrothieno[3,2-e]thiazin-4-yl]acetamide |
| SMILES | CCN(C(C)=O)[C@H]1CN(CCCOC)S(=O)(=O)c2sc(S(N)(=O)=O)cc21 |
| InChI | InChI=1S/C14H23N3O6S3/c1-4-17(10(2)18)12-9-16(6-5-7-23-3)26(21,22)14-11(12)8-13(24-14)25(15,19)20/h8,12H,4-7,9H2,1-3H3,(H2,15,19,20)/t12-/m0/s1 |
| InChIKey | UPKBKYQWORUHMY-LBPRGKRZSA-N |
| XLogP | 0.35 |
| TPSA | 127.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|