C12H14ClN3O2PtS — CID 54752290
N'-[(Z)-(5,6-dimethoxy-2,3-dihydroinden-1-ylidene)amino]carbamimidothioate;platinum(2+);chloride (PubChem CID 54752290) has the molecular formula C12H14ClN3O2PtS and a molecular weight of 494.86 g/mol. Its IUPAC name is N'-[(Z)-(5,6-dimethoxy-2,3-dihydroinden-1-ylidene)amino]carbamimidothioate;platinum(2+);chloride.
| Compound Name | N'-[(Z)-(5,6-dimethoxy-2,3-dihydroinden-1-ylidene)amino]carbamimidothioate;platinum(2+);chloride |
|---|---|
| PubChem CID | 54752290 |
| Molecular Formula | C12H14ClN3O2PtS |
| Molecular Weight | 494.86 g/mol |
| Exact Mass | 494.01 |
| IUPAC Name | N'-[(Z)-(5,6-dimethoxy-2,3-dihydroinden-1-ylidene)amino]carbamimidothioate;platinum(2+);chloride |
| SMILES | COc1cc2c(cc1OC)/C(=N\N=C(/N)[S-])CC2.[Cl-].[Pt+2] |
| InChI | InChI=1S/C12H15N3O2S.ClH.Pt/c1-16-10-5-7-3-4-9(14-15-12(13)18)8(7)6-11(10)17-2;;/h5-6H,3-4H2,1-2H3,(H3,13,15,18);1H;/q;;+2/p-2/b14-9-;; |
| InChIKey | UGLBIVPIVNCGKA-SLYOBIJPSA-L |
| XLogP | -1.78 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.86 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|