C24H28ClN3O6S — CID 54752445
4-(4-chlorophenoxy)-N-[(6R)-1-hydroxy-7-oxo-5,6-dihydro-2H-azepin-6-yl]-N-(2-morpholin-4-ylethyl)benzenesulfonamide (PubChem CID 54752445) has the molecular formula C24H28ClN3O6S and a molecular weight of 522.02 g/mol. Its IUPAC name is 4-(4-chlorophenoxy)-N-[(6R)-1-hydroxy-7-oxo-5,6-dihydro-2H-azepin-6-yl]-N-(2-morpholin-4-ylethyl)benzenesulfonamide.
| Compound Name | 4-(4-chlorophenoxy)-N-[(6R)-1-hydroxy-7-oxo-5,6-dihydro-2H-azepin-6-yl]-N-(2-morpholin-4-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 54752445 |
| Molecular Formula | C24H28ClN3O6S |
| Molecular Weight | 522.02 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | 4-(4-chlorophenoxy)-N-[(6R)-1-hydroxy-7-oxo-5,6-dihydro-2H-azepin-6-yl]-N-(2-morpholin-4-ylethyl)benzenesulfonamide |
| SMILES | O=C1[C@H](N(CCN2CCOCC2)S(=O)(=O)c2ccc(Oc3ccc(Cl)cc3)cc2)CC=CCN1O |
| InChI | InChI=1S/C24H28ClN3O6S/c25-19-4-6-20(7-5-19)34-21-8-10-22(11-9-21)35(31,32)28(14-13-26-15-17-33-18-16-26)23-3-1-2-12-27(30)24(23)29/h1-2,4-11,23,30H,3,12-18H2/t23-/m1/s1 |
| InChIKey | YBTXAIOMVIXCOD-HSZRJFAPSA-N |
| XLogP | 3.00 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.02 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|