About (2R,4S)-4-benzyl-3-(4-methylphenyl)sulfonyloxathiazolidine 2-oxide
(2R,4S)-4-benzyl-3-(4-methylphenyl)sulfonyloxathiazolidine 2-oxide (PubChem CID 54752481) has the molecular formula C16H17NO4S2
and a molecular weight of 351.45 g/mol. Its IUPAC name is (2R,4S)-4-benzyl-3-(4-methylphenyl)sulfonyloxathiazolidine 2-oxide.
Molecular Properties
| Compound Name | (2R,4S)-4-benzyl-3-(4-methylphenyl)sulfonyloxathiazolidine 2-oxide |
| PubChem CID | 54752481 |
| Molecular Formula | C16H17NO4S2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | (2R,4S)-4-benzyl-3-(4-methylphenyl)sulfonyloxathiazolidine 2-oxide |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@@H](Cc3ccccc3)CO[S@]2=O)cc1 |
| InChI | InChI=1S/C16H17NO4S2/c1-13-7-9-16(10-8-13)23(19,20)17-15(12-21-22(17)18)11-14-5-3-2-4-6-14/h2-10,15H,11-12H2,1H3/t15-,22+/m0/s1 |
| InChIKey | VKLFRIFLTURBKX-OYHNWAKOSA-N |
| XLogP | 2.21 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R,4S)-4-benzyl-3-(4-methylphenyl)sulfonyloxathiazolidine 2-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,4S)-4-benzyl-3-(4-methylphenyl)sulfonyloxathiazolidine 2-oxide?
The IUPAC name of (2R,4S)-4-benzyl-3-(4-methylphenyl)sulfonyloxathiazolidine 2-oxide (CID 54752481) is (2R,4S)-4-benzyl-3-(4-methylphenyl)sulfonyloxathiazolidine 2-oxide.
What is the SMILES notation for (2R,4S)-4-benzyl-3-(4-methylphenyl)sulfonyloxathiazolidine 2-oxide?
The canonical SMILES for (2R,4S)-4-benzyl-3-(4-methylphenyl)sulfonyloxathiazolidine 2-oxide is Cc1ccc(S(=O)(=O)N2[C@@H](Cc3ccccc3)CO[S@]2=O)cc1.
What is the InChIKey of (2R,4S)-4-benzyl-3-(4-methylphenyl)sulfonyloxathiazolidine 2-oxide?
The InChIKey is VKLFRIFLTURBKX-OYHNWAKOSA-N. The full InChI is InChI=1S/C16H17NO4S2/c1-13-7-9-16(10-8-13)23(19,20)17-15(12-21-22(17)18)11-14-5-3-2-4-6-14/h2-10,15H,11-12H2,1H3/t15-,22+/m0/s1.
What are the key properties of (2R,4S)-4-benzyl-3-(4-methylphenyl)sulfonyloxathiazolidine 2-oxide?
(2R,4S)-4-benzyl-3-(4-methylphenyl)sulfonyloxathiazolidine 2-oxide has a molecular weight of 351.45 g/mol, XLogP of 2.21, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,4S)-4-benzyl-3-(4-methylphenyl)sulfonyloxathiazolidine 2-oxide is sourced from PubChem (CID 54752481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).