C37H52FNO11 — CID 54752891
[(2R,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[[(R)-(4-fluorophenyl)-[(2S)-5-oxo-2H-furan-2-yl]methyl]amino]oxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 54752891) has the molecular formula C37H52FNO11 and a molecular weight of 705.82 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[[(R)-(4-fluorophenyl)-[(2S)-5-oxo-2H-furan-2-yl]methyl]amino]oxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[[(R)-(4-fluorophenyl)-[(2S)-5-oxo-2H-furan-2-yl]methyl]amino]oxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 54752891 |
| Molecular Formula | C37H52FNO11 |
| Molecular Weight | 705.82 g/mol |
| Exact Mass | 705.35 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[[(R)-(4-fluorophenyl)-[(2S)-5-oxo-2H-furan-2-yl]methyl]amino]oxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC[C@H]1O[C@@H](N[C@H](c2ccc(F)cc2)[C@@H]2C=CC(=O)O2)[C@H](OC(=O)C(C)(C)C)[C@@H](OC(=O)C(C)(C)C)[C@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C37H52FNO11/c1-34(2,3)30(41)45-19-23-26(48-31(42)35(4,5)6)27(49-32(43)36(7,8)9)28(50-33(44)37(10,11)12)29(47-23)39-25(22-17-18-24(40)46-22)20-13-15-21(38)16-14-20/h13-18,22-23,25-29,39H,19H2,1-12H3/t22-,23+,25+,26-,27-,28+,29+/m0/s1 |
| InChIKey | CFEHSAFWPLCOHS-FJVPFQQSSA-N |
| XLogP | 5.13 |
| TPSA | 152.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.82 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|