About [1,8-bis(dimethylamino)naphthalen-2-yl]-[2-(dimethylamino)phenyl]methanol
[1,8-bis(dimethylamino)naphthalen-2-yl]-[2-(dimethylamino)phenyl]methanol (PubChem CID 54753234) has the molecular formula C23H29N3O
and a molecular weight of 363.51 g/mol. Its IUPAC name is [1,8-bis(dimethylamino)naphthalen-2-yl]-[2-(dimethylamino)phenyl]methanol.
Molecular Properties
| Compound Name | [1,8-bis(dimethylamino)naphthalen-2-yl]-[2-(dimethylamino)phenyl]methanol |
| PubChem CID | 54753234 |
| Molecular Formula | C23H29N3O |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | [1,8-bis(dimethylamino)naphthalen-2-yl]-[2-(dimethylamino)phenyl]methanol |
| SMILES | CN(C)c1ccccc1C(O)c1ccc2cccc(N(C)C)c2c1N(C)C |
| InChI | InChI=1S/C23H29N3O/c1-24(2)19-12-8-7-11-17(19)23(27)18-15-14-16-10-9-13-20(25(3)4)21(16)22(18)26(5)6/h7-15,23,27H,1-6H3 |
| InChIKey | PBCSCUJLUJOLEE-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1,8-bis(dimethylamino)naphthalen-2-yl]-[2-(dimethylamino)phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,8-bis(dimethylamino)naphthalen-2-yl]-[2-(dimethylamino)phenyl]methanol?
The IUPAC name of [1,8-bis(dimethylamino)naphthalen-2-yl]-[2-(dimethylamino)phenyl]methanol (CID 54753234) is [1,8-bis(dimethylamino)naphthalen-2-yl]-[2-(dimethylamino)phenyl]methanol.
What is the SMILES notation for [1,8-bis(dimethylamino)naphthalen-2-yl]-[2-(dimethylamino)phenyl]methanol?
The canonical SMILES for [1,8-bis(dimethylamino)naphthalen-2-yl]-[2-(dimethylamino)phenyl]methanol is CN(C)c1ccccc1C(O)c1ccc2cccc(N(C)C)c2c1N(C)C.
What is the InChIKey of [1,8-bis(dimethylamino)naphthalen-2-yl]-[2-(dimethylamino)phenyl]methanol?
The InChIKey is PBCSCUJLUJOLEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H29N3O/c1-24(2)19-12-8-7-11-17(19)23(27)18-15-14-16-10-9-13-20(25(3)4)21(16)22(18)26(5)6/h7-15,23,27H,1-6H3.
What are the key properties of [1,8-bis(dimethylamino)naphthalen-2-yl]-[2-(dimethylamino)phenyl]methanol?
[1,8-bis(dimethylamino)naphthalen-2-yl]-[2-(dimethylamino)phenyl]methanol has a molecular weight of 363.51 g/mol, XLogP of 4.12, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1,8-bis(dimethylamino)naphthalen-2-yl]-[2-(dimethylamino)phenyl]methanol is sourced from PubChem (CID 54753234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).