C14H15ClN6O — CID 54753437
12-chloro-6-[(3R)-3-(methylamino)pyrrolidin-1-yl]-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-4-amine (PubChem CID 54753437) has the molecular formula C14H15ClN6O and a molecular weight of 318.77 g/mol. Its IUPAC name is 12-chloro-6-[(3R)-3-(methylamino)pyrrolidin-1-yl]-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-4-amine.
| Compound Name | 12-chloro-6-[(3R)-3-(methylamino)pyrrolidin-1-yl]-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-4-amine |
|---|---|
| PubChem CID | 54753437 |
| Molecular Formula | C14H15ClN6O |
| Molecular Weight | 318.77 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 12-chloro-6-[(3R)-3-(methylamino)pyrrolidin-1-yl]-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-4-amine |
| SMILES | CN[C@@H]1CCN(c2nc(N)nc3c2oc2ncc(Cl)cc23)C1 |
| InChI | InChI=1S/C14H15ClN6O/c1-17-8-2-3-21(6-8)12-11-10(19-14(16)20-12)9-4-7(15)5-18-13(9)22-11/h4-5,8,17H,2-3,6H2,1H3,(H2,16,19,20)/t8-/m1/s1 |
| InChIKey | QCLILBHBGZEDKK-MRVPVSSYSA-N |
| XLogP | 1.80 |
| TPSA | 93.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.77 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |