C22H23N3O4 — CID 54753440
1-[(2R,4S,5R)-5-[(benzhydrylamino)methyl]-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 54753440) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-5-[(benzhydrylamino)methyl]-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-5-[(benzhydrylamino)methyl]-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 54753440 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 1-[(2R,4S,5R)-5-[(benzhydrylamino)methyl]-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn([C@H]2C[C@H](O)[C@@H](CNC(c3ccccc3)c3ccccc3)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C22H23N3O4/c26-17-13-20(25-12-11-19(27)24-22(25)28)29-18(17)14-23-21(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-12,17-18,20-21,23,26H,13-14H2,(H,24,27,28)/t17-,18+,20+/m0/s1 |
| InChIKey | JJVBLAPDVHVENR-NLWGTHIKSA-N |
| XLogP | 1.56 |
| TPSA | 96.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |