C7H11NO5 — CID 54753457
(6S,7R,8S,8aR)-6,7,8-trihydroxy-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one (PubChem CID 54753457) has the molecular formula C7H11NO5 and a molecular weight of 189.17 g/mol. Its IUPAC name is (6S,7R,8S,8aR)-6,7,8-trihydroxy-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one.
| Compound Name | (6S,7R,8S,8aR)-6,7,8-trihydroxy-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
|---|---|
| PubChem CID | 54753457 |
| Molecular Formula | C7H11NO5 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | (6S,7R,8S,8aR)-6,7,8-trihydroxy-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
| SMILES | O=C1OC[C@@H]2[C@H](O)[C@H](O)[C@@H](O)CN12 |
| InChI | InChI=1S/C7H11NO5/c9-4-1-8-3(2-13-7(8)12)5(10)6(4)11/h3-6,9-11H,1-2H2/t3-,4+,5+,6-/m1/s1 |
| InChIKey | GTTBBVFZKUCUGG-DPYQTVNSSA-N |
| XLogP | -2.10 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |