C30H50ClN — CID 54753646
6,8-bis[(Z)-dec-1-enyl]-5,7-dimethyl-2,3-dihydro-1H-indolizin-4-ium chloride (PubChem CID 54753646) has the molecular formula C30H50ClN and a molecular weight of 460.19 g/mol. Its IUPAC name is 6,8-bis[(Z)-dec-1-enyl]-5,7-dimethyl-2,3-dihydro-1H-indolizin-4-ium chloride.
| Compound Name | 6,8-bis[(Z)-dec-1-enyl]-5,7-dimethyl-2,3-dihydro-1H-indolizin-4-ium chloride |
|---|---|
| PubChem CID | 54753646 |
| Molecular Formula | C30H50ClN |
| Molecular Weight | 460.19 g/mol |
| Exact Mass | 459.36 |
| IUPAC Name | 6,8-bis[(Z)-dec-1-enyl]-5,7-dimethyl-2,3-dihydro-1H-indolizin-4-ium chloride |
| SMILES | CCCCCCCC/C=C\c1c(C)c(/C=C\CCCCCCCC)c2[n+](c1C)CCC2.[Cl-] |
| InChI | InChI=1S/C30H50N.ClH/c1-5-7-9-11-13-15-17-19-22-28-26(3)29(30-24-21-25-31(30)27(28)4)23-20-18-16-14-12-10-8-6-2;/h19-20,22-23H,5-18,21,24-25H2,1-4H3;1H/q+1;/p-1/b22-19-,23-20-; |
| InChIKey | OMROJUVOEABBEY-HDZLQULISA-M |
| XLogP | 6.07 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.19 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|