C13H12N4S — CID 54753801
6,14-dimethyl-10-thia-12,13,15,16-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,11,13-hexaene (PubChem CID 54753801) has the molecular formula C13H12N4S and a molecular weight of 256.33 g/mol. Its IUPAC name is 6,14-dimethyl-10-thia-12,13,15,16-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,11,13-hexaene.
| Compound Name | 6,14-dimethyl-10-thia-12,13,15,16-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,11,13-hexaene |
|---|---|
| PubChem CID | 54753801 |
| Molecular Formula | C13H12N4S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 6,14-dimethyl-10-thia-12,13,15,16-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,11,13-hexaene |
| SMILES | Cc1cccc2c1CC1Sc3nnc(C)n3N=C21 |
| InChI | InChI=1S/C13H12N4S/c1-7-4-3-5-9-10(7)6-11-12(9)16-17-8(2)14-15-13(17)18-11/h3-5,11H,6H2,1-2H3 |
| InChIKey | NGJKNHNQNRKKDO-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |