C33H29N5O2 — CID 54753804
N-(8-oxo-16-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaen-5-yl)-2-[2-(1,2,3,4-tetrahydroacridin-9-ylamino)ethylamino]acetamide (PubChem CID 54753804) has the molecular formula C33H29N5O2 and a molecular weight of 527.63 g/mol. Its IUPAC name is N-(8-oxo-16-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaen-5-yl)-2-[2-(1,2,3,4-tetrahydroacridin-9-ylamino)ethylamino]acetamide.
| Compound Name | N-(8-oxo-16-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaen-5-yl)-2-[2-(1,2,3,4-tetrahydroacridin-9-ylamino)ethylamino]acetamide |
|---|---|
| PubChem CID | 54753804 |
| Molecular Formula | C33H29N5O2 |
| Molecular Weight | 527.63 g/mol |
| Exact Mass | 527.23 |
| IUPAC Name | N-(8-oxo-16-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaen-5-yl)-2-[2-(1,2,3,4-tetrahydroacridin-9-ylamino)ethylamino]acetamide |
| SMILES | O=C(CNCCNc1c2c(nc3ccccc13)CCCC2)Nc1ccc2c(c1)C(=O)c1cccc3ccnc-2c13 |
| InChI | InChI=1S/C33H29N5O2/c39-29(19-34-16-17-36-31-23-7-1-3-10-27(23)38-28-11-4-2-8-24(28)31)37-21-12-13-22-26(18-21)33(40)25-9-5-6-20-14-15-35-32(22)30(20)25/h1,3,5-7,9-10,12-15,18,34H,2,4,8,11,16-17,19H2,(H,36,38)(H,37,39) |
| InChIKey | DIWGQLKDVUAWID-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.63 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|