C34H31N5O2 — CID 54753805
N-(8-oxo-16-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaen-5-yl)-3-[2-(1,2,3,4-tetrahydroacridin-9-ylamino)ethylamino]propanamide (PubChem CID 54753805) has the molecular formula C34H31N5O2 and a molecular weight of 541.66 g/mol. Its IUPAC name is N-(8-oxo-16-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaen-5-yl)-3-[2-(1,2,3,4-tetrahydroacridin-9-ylamino)ethylamino]propanamide.
| Compound Name | N-(8-oxo-16-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaen-5-yl)-3-[2-(1,2,3,4-tetrahydroacridin-9-ylamino)ethylamino]propanamide |
|---|---|
| PubChem CID | 54753805 |
| Molecular Formula | C34H31N5O2 |
| Molecular Weight | 541.66 g/mol |
| Exact Mass | 541.25 |
| IUPAC Name | N-(8-oxo-16-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaen-5-yl)-3-[2-(1,2,3,4-tetrahydroacridin-9-ylamino)ethylamino]propanamide |
| SMILES | O=C(CCNCCNc1c2c(nc3ccccc13)CCCC2)Nc1ccc2c(c1)C(=O)c1cccc3ccnc-2c13 |
| InChI | InChI=1S/C34H31N5O2/c40-30(15-16-35-18-19-37-32-24-7-1-3-10-28(24)39-29-11-4-2-8-25(29)32)38-22-12-13-23-27(20-22)34(41)26-9-5-6-21-14-17-36-33(23)31(21)26/h1,3,5-7,9-10,12-14,17,20,35H,2,4,8,11,15-16,18-19H2,(H,37,39)(H,38,40) |
| InChIKey | ULABGWUYZRTDHX-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.66 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|