C13H10N4O3S — CID 54754350
N-[6-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]imidazo[1,2-a]pyridin-2-yl]acetamide (PubChem CID 54754350) has the molecular formula C13H10N4O3S and a molecular weight of 302.32 g/mol. Its IUPAC name is N-[6-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]imidazo[1,2-a]pyridin-2-yl]acetamide.
| Compound Name | N-[6-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]imidazo[1,2-a]pyridin-2-yl]acetamide |
|---|---|
| PubChem CID | 54754350 |
| Molecular Formula | C13H10N4O3S |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | N-[6-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]imidazo[1,2-a]pyridin-2-yl]acetamide |
| SMILES | CC(=O)Nc1cn2cc(/C=C3\SC(=O)NC3=O)ccc2n1 |
| InChI | InChI=1S/C13H10N4O3S/c1-7(18)14-10-6-17-5-8(2-3-11(17)15-10)4-9-12(19)16-13(20)21-9/h2-6H,1H3,(H,14,18)(H,16,19,20)/b9-4- |
| InChIKey | CCECKHDWHUIQQG-WTKPLQERSA-N |
| XLogP | 1.62 |
| TPSA | 92.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|