C17H11Cl2FN4OS — CID 54755280
8-chloro-N-(2-chloro-4-pyridinyl)-7-fluoro-1-methyl-4H-imidazo[5,1-c][1,4]benzothiazine-3-carboxamide (PubChem CID 54755280) has the molecular formula C17H11Cl2FN4OS and a molecular weight of 409.27 g/mol. Its IUPAC name is 8-chloro-N-(2-chloro-4-pyridinyl)-7-fluoro-1-methyl-4H-imidazo[5,1-c][1,4]benzothiazine-3-carboxamide.
| Compound Name | 8-chloro-N-(2-chloro-4-pyridinyl)-7-fluoro-1-methyl-4H-imidazo[5,1-c][1,4]benzothiazine-3-carboxamide |
|---|---|
| PubChem CID | 54755280 |
| Molecular Formula | C17H11Cl2FN4OS |
| Molecular Weight | 409.27 g/mol |
| Exact Mass | 408.00 |
| IUPAC Name | 8-chloro-N-(2-chloro-4-pyridinyl)-7-fluoro-1-methyl-4H-imidazo[5,1-c][1,4]benzothiazine-3-carboxamide |
| SMILES | Cc1nc(C(=O)Nc2ccnc(Cl)c2)c2n1-c1cc(Cl)c(F)cc1SC2 |
| InChI | InChI=1S/C17H11Cl2FN4OS/c1-8-22-16(17(25)23-9-2-3-21-15(19)4-9)13-7-26-14-6-11(20)10(18)5-12(14)24(8)13/h2-6H,7H2,1H3,(H,21,23,25) |
| InChIKey | KWCMHCQBYDJPJX-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.27 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|