C27H29FN6O2S — CID 54755425
8-ethyl-6-(2-fluoro-5-methylsulfinylphenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 54755425) has the molecular formula C27H29FN6O2S and a molecular weight of 520.63 g/mol. Its IUPAC name is 8-ethyl-6-(2-fluoro-5-methylsulfinylphenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-ethyl-6-(2-fluoro-5-methylsulfinylphenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 54755425 |
| Molecular Formula | C27H29FN6O2S |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | 8-ethyl-6-(2-fluoro-5-methylsulfinylphenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCn1c(=O)c(-c2cc(S(C)=O)ccc2F)cc2cnc(Nc3ccc(N4CCN(C)CC4)cc3)nc21 |
| InChI | InChI=1S/C27H29FN6O2S/c1-4-34-25-18(15-23(26(34)35)22-16-21(37(3)36)9-10-24(22)28)17-29-27(31-25)30-19-5-7-20(8-6-19)33-13-11-32(2)12-14-33/h5-10,15-17H,4,11-14H2,1-3H3,(H,29,30,31) |
| InChIKey | AFCJZULCWJKSDR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|