C26H24FN7O3S — CID 54755564
2-(3-fluoro-4-piperazin-1-ylanilino)-8-[(2-methylsulfonylphenyl)methyl]-7-oxopyrido[2,3-d]pyrimidine-6-carbonitrile (PubChem CID 54755564) has the molecular formula C26H24FN7O3S and a molecular weight of 533.59 g/mol. Its IUPAC name is 2-(3-fluoro-4-piperazin-1-ylanilino)-8-[(2-methylsulfonylphenyl)methyl]-7-oxopyrido[2,3-d]pyrimidine-6-carbonitrile.
| Compound Name | 2-(3-fluoro-4-piperazin-1-ylanilino)-8-[(2-methylsulfonylphenyl)methyl]-7-oxopyrido[2,3-d]pyrimidine-6-carbonitrile |
|---|---|
| PubChem CID | 54755564 |
| Molecular Formula | C26H24FN7O3S |
| Molecular Weight | 533.59 g/mol |
| Exact Mass | 533.16 |
| IUPAC Name | 2-(3-fluoro-4-piperazin-1-ylanilino)-8-[(2-methylsulfonylphenyl)methyl]-7-oxopyrido[2,3-d]pyrimidine-6-carbonitrile |
| SMILES | CS(=O)(=O)c1ccccc1Cn1c(=O)c(C#N)cc2cnc(Nc3ccc(N4CCNCC4)c(F)c3)nc21 |
| InChI | InChI=1S/C26H24FN7O3S/c1-38(36,37)23-5-3-2-4-17(23)16-34-24-19(12-18(14-28)25(34)35)15-30-26(32-24)31-20-6-7-22(21(27)13-20)33-10-8-29-9-11-33/h2-7,12-13,15,29H,8-11,16H2,1H3,(H,30,31,32) |
| InChIKey | WPTBFMPJHMFDKN-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 133.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.59 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|