C31H28ClFN6O3S — CID 54755565
6-(2-chlorophenyl)-2-(3-fluoro-4-piperazin-1-ylanilino)-8-[(2-methylsulfonylphenyl)methyl]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 54755565) has the molecular formula C31H28ClFN6O3S and a molecular weight of 619.12 g/mol. Its IUPAC name is 6-(2-chlorophenyl)-2-(3-fluoro-4-piperazin-1-ylanilino)-8-[(2-methylsulfonylphenyl)methyl]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-(2-chlorophenyl)-2-(3-fluoro-4-piperazin-1-ylanilino)-8-[(2-methylsulfonylphenyl)methyl]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 54755565 |
| Molecular Formula | C31H28ClFN6O3S |
| Molecular Weight | 619.12 g/mol |
| Exact Mass | 618.16 |
| IUPAC Name | 6-(2-chlorophenyl)-2-(3-fluoro-4-piperazin-1-ylanilino)-8-[(2-methylsulfonylphenyl)methyl]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CS(=O)(=O)c1ccccc1Cn1c(=O)c(-c2ccccc2Cl)cc2cnc(Nc3ccc(N4CCNCC4)c(F)c3)nc21 |
| InChI | InChI=1S/C31H28ClFN6O3S/c1-43(41,42)28-9-5-2-6-20(28)19-39-29-21(16-24(30(39)40)23-7-3-4-8-25(23)32)18-35-31(37-29)36-22-10-11-27(26(33)17-22)38-14-12-34-13-15-38/h2-11,16-18,34H,12-15,19H2,1H3,(H,35,36,37) |
| InChIKey | YPCASKCHNNTQLH-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.12 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|