C25H27ClN2O3 — CID 54755840
4-[(6-chloro-3-pyridinyl)methyl]-1-ethoxy-N-[(1S,2S)-2-hydroxycyclohexyl]naphthalene-2-carboxamide (PubChem CID 54755840) has the molecular formula C25H27ClN2O3 and a molecular weight of 438.96 g/mol. Its IUPAC name is 4-[(6-chloro-3-pyridinyl)methyl]-1-ethoxy-N-[(1S,2S)-2-hydroxycyclohexyl]naphthalene-2-carboxamide.
| Compound Name | 4-[(6-chloro-3-pyridinyl)methyl]-1-ethoxy-N-[(1S,2S)-2-hydroxycyclohexyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 54755840 |
| Molecular Formula | C25H27ClN2O3 |
| Molecular Weight | 438.96 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 4-[(6-chloro-3-pyridinyl)methyl]-1-ethoxy-N-[(1S,2S)-2-hydroxycyclohexyl]naphthalene-2-carboxamide |
| SMILES | CCOc1c(C(=O)N[C@H]2CCCC[C@@H]2O)cc(Cc2ccc(Cl)nc2)c2ccccc12 |
| InChI | InChI=1S/C25H27ClN2O3/c1-2-31-24-19-8-4-3-7-18(19)17(13-16-11-12-23(26)27-15-16)14-20(24)25(30)28-21-9-5-6-10-22(21)29/h3-4,7-8,11-12,14-15,21-22,29H,2,5-6,9-10,13H2,1H3,(H,28,30)/t21-,22-/m0/s1 |
| InChIKey | ZQESGELAJPFMME-VXKWHMMOSA-N |
| XLogP | 4.91 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.96 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|