About nickel;bis((6Z)-6-[(propan-2-ylamino)methylidene]cyclohexa-2,4-dien-1-one)
nickel;bis((6Z)-6-[(propan-2-ylamino)methylidene]cyclohexa-2,4-dien-1-one) (PubChem CID 5475600) has the molecular formula C20H26N2NiO2
and a molecular weight of 385.13 g/mol. Its IUPAC name is nickel;bis((6Z)-6-[(propan-2-ylamino)methylidene]cyclohexa-2,4-dien-1-one).
Molecular Properties
| Compound Name | nickel;bis((6Z)-6-[(propan-2-ylamino)methylidene]cyclohexa-2,4-dien-1-one) |
| PubChem CID | 5475600 |
| Molecular Formula | C20H26N2NiO2 |
| Molecular Weight | 385.13 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | nickel;bis((6Z)-6-[(propan-2-ylamino)methylidene]cyclohexa-2,4-dien-1-one) |
| SMILES | CC(C)N/C=C1/C=CC=CC1=O.CC(C)N/C=C1/C=CC=CC1=O.[Ni] |
| InChI | InChI=1S/2C10H13NO.Ni/c2*1-8(2)11-7-9-5-3-4-6-10(9)12;/h2*3-8,11H,1-2H3;/b2*9-7-; |
| InChIKey | PJGPQJCPGOTKAG-LHSHWCRNSA-N |
| XLogP | 3.12 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.13 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze nickel;bis((6Z)-6-[(propan-2-ylamino)methylidene]cyclohexa-2,4-dien-1-one) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nickel;bis((6Z)-6-[(propan-2-ylamino)methylidene]cyclohexa-2,4-dien-1-one)?
The IUPAC name of nickel;bis((6Z)-6-[(propan-2-ylamino)methylidene]cyclohexa-2,4-dien-1-one) (CID 5475600) is nickel;bis((6Z)-6-[(propan-2-ylamino)methylidene]cyclohexa-2,4-dien-1-one).
What is the SMILES notation for nickel;bis((6Z)-6-[(propan-2-ylamino)methylidene]cyclohexa-2,4-dien-1-one)?
The canonical SMILES for nickel;bis((6Z)-6-[(propan-2-ylamino)methylidene]cyclohexa-2,4-dien-1-one) is CC(C)N/C=C1/C=CC=CC1=O.CC(C)N/C=C1/C=CC=CC1=O.[Ni].
What is the InChIKey of nickel;bis((6Z)-6-[(propan-2-ylamino)methylidene]cyclohexa-2,4-dien-1-one)?
The InChIKey is PJGPQJCPGOTKAG-LHSHWCRNSA-N. The full InChI is InChI=1S/2C10H13NO.Ni/c2*1-8(2)11-7-9-5-3-4-6-10(9)12;/h2*3-8,11H,1-2H3;/b2*9-7-;.
What are the key properties of nickel;bis((6Z)-6-[(propan-2-ylamino)methylidene]cyclohexa-2,4-dien-1-one)?
nickel;bis((6Z)-6-[(propan-2-ylamino)methylidene]cyclohexa-2,4-dien-1-one) has a molecular weight of 385.13 g/mol, XLogP of 3.12, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for nickel;bis((6Z)-6-[(propan-2-ylamino)methylidene]cyclohexa-2,4-dien-1-one) is sourced from PubChem (CID 5475600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).