About bis((6Z)-6-[(cyclohexylamino)methylidene]cyclohexa-2,4-dien-1-one);nickel
bis((6Z)-6-[(cyclohexylamino)methylidene]cyclohexa-2,4-dien-1-one);nickel (PubChem CID 5475606) has the molecular formula C26H34N2NiO2
and a molecular weight of 465.26 g/mol. Its IUPAC name is bis((6Z)-6-[(cyclohexylamino)methylidene]cyclohexa-2,4-dien-1-one);nickel.
Molecular Properties
| Compound Name | bis((6Z)-6-[(cyclohexylamino)methylidene]cyclohexa-2,4-dien-1-one);nickel |
| PubChem CID | 5475606 |
| Molecular Formula | C26H34N2NiO2 |
| Molecular Weight | 465.26 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | bis((6Z)-6-[(cyclohexylamino)methylidene]cyclohexa-2,4-dien-1-one);nickel |
| SMILES | O=C1C=CC=C/C1=C/NC1CCCCC1.O=C1C=CC=C/C1=C/NC1CCCCC1.[Ni] |
| InChI | InChI=1S/2C13H17NO.Ni/c2*15-13-9-5-4-6-11(13)10-14-12-7-2-1-3-8-12;/h2*4-6,9-10,12,14H,1-3,7-8H2;/b2*11-10-; |
| InChIKey | LAOXCXZLCSXLRR-DEZACRSWSA-N |
| XLogP | 4.97 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 465.26 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis((6Z)-6-[(cyclohexylamino)methylidene]cyclohexa-2,4-dien-1-one);nickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((6Z)-6-[(cyclohexylamino)methylidene]cyclohexa-2,4-dien-1-one);nickel?
The IUPAC name of bis((6Z)-6-[(cyclohexylamino)methylidene]cyclohexa-2,4-dien-1-one);nickel (CID 5475606) is bis((6Z)-6-[(cyclohexylamino)methylidene]cyclohexa-2,4-dien-1-one);nickel.
What is the SMILES notation for bis((6Z)-6-[(cyclohexylamino)methylidene]cyclohexa-2,4-dien-1-one);nickel?
The canonical SMILES for bis((6Z)-6-[(cyclohexylamino)methylidene]cyclohexa-2,4-dien-1-one);nickel is O=C1C=CC=C/C1=C/NC1CCCCC1.O=C1C=CC=C/C1=C/NC1CCCCC1.[Ni].
What is the InChIKey of bis((6Z)-6-[(cyclohexylamino)methylidene]cyclohexa-2,4-dien-1-one);nickel?
The InChIKey is LAOXCXZLCSXLRR-DEZACRSWSA-N. The full InChI is InChI=1S/2C13H17NO.Ni/c2*15-13-9-5-4-6-11(13)10-14-12-7-2-1-3-8-12;/h2*4-6,9-10,12,14H,1-3,7-8H2;/b2*11-10-;.
What are the key properties of bis((6Z)-6-[(cyclohexylamino)methylidene]cyclohexa-2,4-dien-1-one);nickel?
bis((6Z)-6-[(cyclohexylamino)methylidene]cyclohexa-2,4-dien-1-one);nickel has a molecular weight of 465.26 g/mol, XLogP of 4.97, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis((6Z)-6-[(cyclohexylamino)methylidene]cyclohexa-2,4-dien-1-one);nickel is sourced from PubChem (CID 5475606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).