C21H31BO3 — CID 54756216
(2E)-1-cyclopropyl-1-phenyl-2-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]pentan-1-ol (PubChem CID 54756216) has the molecular formula C21H31BO3 and a molecular weight of 342.29 g/mol. Its IUPAC name is (2E)-1-cyclopropyl-1-phenyl-2-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]pentan-1-ol.
| Compound Name | (2E)-1-cyclopropyl-1-phenyl-2-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]pentan-1-ol |
|---|---|
| PubChem CID | 54756216 |
| Molecular Formula | C21H31BO3 |
| Molecular Weight | 342.29 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | (2E)-1-cyclopropyl-1-phenyl-2-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]pentan-1-ol |
| SMILES | CCC/C(=C\B1OC(C)(C)C(C)(C)O1)C(O)(c1ccccc1)C1CC1 |
| InChI | InChI=1S/C21H31BO3/c1-6-10-18(15-22-24-19(2,3)20(4,5)25-22)21(23,17-13-14-17)16-11-8-7-9-12-16/h7-9,11-12,15,17,23H,6,10,13-14H2,1-5H3/b18-15+ |
| InChIKey | KMCNDMKHAVRERV-OBGWFSINSA-N |
| XLogP | 4.64 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.29 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|