About [(Z)-3-(4-chlorophenyl)-2,3-diphenylprop-2-enyl] 4-methylbenzenesulfonate
[(Z)-3-(4-chlorophenyl)-2,3-diphenylprop-2-enyl] 4-methylbenzenesulfonate (PubChem CID 5475646) has the molecular formula C28H23ClO3S
and a molecular weight of 475.01 g/mol. Its IUPAC name is [(Z)-3-(4-chlorophenyl)-2,3-diphenylprop-2-enyl] 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | [(Z)-3-(4-chlorophenyl)-2,3-diphenylprop-2-enyl] 4-methylbenzenesulfonate |
| PubChem CID | 5475646 |
| Molecular Formula | C28H23ClO3S |
| Molecular Weight | 475.01 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | [(Z)-3-(4-chlorophenyl)-2,3-diphenylprop-2-enyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC/C(=C(/c2ccccc2)c2ccc(Cl)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H23ClO3S/c1-21-12-18-26(19-13-21)33(30,31)32-20-27(22-8-4-2-5-9-22)28(23-10-6-3-7-11-23)24-14-16-25(29)17-15-24/h2-19H,20H2,1H3/b28-27+ |
| InChIKey | YPHREQJJBWTFGZ-BYYHNAKLSA-N |
| XLogP | 7.01 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 475.01 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-3-(4-chlorophenyl)-2,3-diphenylprop-2-enyl] 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-3-(4-chlorophenyl)-2,3-diphenylprop-2-enyl] 4-methylbenzenesulfonate?
The IUPAC name of [(Z)-3-(4-chlorophenyl)-2,3-diphenylprop-2-enyl] 4-methylbenzenesulfonate (CID 5475646) is [(Z)-3-(4-chlorophenyl)-2,3-diphenylprop-2-enyl] 4-methylbenzenesulfonate.
What is the SMILES notation for [(Z)-3-(4-chlorophenyl)-2,3-diphenylprop-2-enyl] 4-methylbenzenesulfonate?
The canonical SMILES for [(Z)-3-(4-chlorophenyl)-2,3-diphenylprop-2-enyl] 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OC/C(=C(/c2ccccc2)c2ccc(Cl)cc2)c2ccccc2)cc1.
What is the InChIKey of [(Z)-3-(4-chlorophenyl)-2,3-diphenylprop-2-enyl] 4-methylbenzenesulfonate?
The InChIKey is YPHREQJJBWTFGZ-BYYHNAKLSA-N. The full InChI is InChI=1S/C28H23ClO3S/c1-21-12-18-26(19-13-21)33(30,31)32-20-27(22-8-4-2-5-9-22)28(23-10-6-3-7-11-23)24-14-16-25(29)17-15-24/h2-19H,20H2,1H3/b28-27+.
What are the key properties of [(Z)-3-(4-chlorophenyl)-2,3-diphenylprop-2-enyl] 4-methylbenzenesulfonate?
[(Z)-3-(4-chlorophenyl)-2,3-diphenylprop-2-enyl] 4-methylbenzenesulfonate has a molecular weight of 475.01 g/mol, XLogP of 7.01, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-3-(4-chlorophenyl)-2,3-diphenylprop-2-enyl] 4-methylbenzenesulfonate is sourced from PubChem (CID 5475646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).