C14H19NO2 — CID 54756539
(1S,2R,6R,8R)-2-benzyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,6-diol (PubChem CID 54756539) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is (1S,2R,6R,8R)-2-benzyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,6-diol.
| Compound Name | (1S,2R,6R,8R)-2-benzyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,6-diol |
|---|---|
| PubChem CID | 54756539 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | (1S,2R,6R,8R)-2-benzyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,6-diol |
| SMILES | O[C@@H]1C[C@@H]2[C@@H](O)[C@H](Cc3ccccc3)CN2C1 |
| InChI | InChI=1S/C14H19NO2/c16-12-7-13-14(17)11(8-15(13)9-12)6-10-4-2-1-3-5-10/h1-5,11-14,16-17H,6-9H2/t11-,12-,13-,14+/m1/s1 |
| InChIKey | MVCLVJLPZDPIQM-SYQHCUMBSA-N |
| XLogP | 0.65 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |