C17H14BrF3O3S — CID 54756756
(11-bromo-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaenyl) trifluoromethanesulfonate (PubChem CID 54756756) has the molecular formula C17H14BrF3O3S and a molecular weight of 435.26 g/mol. Its IUPAC name is (11-bromo-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaenyl) trifluoromethanesulfonate.
| Compound Name | (11-bromo-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaenyl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 54756756 |
| Molecular Formula | C17H14BrF3O3S |
| Molecular Weight | 435.26 g/mol |
| Exact Mass | 433.98 |
| IUPAC Name | (11-bromo-5-tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaenyl) trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1cc2ccc1CCc1ccc(c(Br)c1)CC2)C(F)(F)F |
| InChI | InChI=1S/C17H14BrF3O3S/c18-15-9-11-1-5-13(15)6-2-12-4-8-14(7-3-11)16(10-12)24-25(22,23)17(19,20)21/h1,4-5,8-10H,2-3,6-7H2 |
| InChIKey | CQUCHBHOAOVKCY-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.26 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|