C19H34O2Si — CID 54756792
(1R,2R,4aS,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-1,2-dimethyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalene-1-carbaldehyde (PubChem CID 54756792) has the molecular formula C19H34O2Si and a molecular weight of 322.57 g/mol. Its IUPAC name is (1R,2R,4aS,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-1,2-dimethyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalene-1-carbaldehyde.
| Compound Name | (1R,2R,4aS,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-1,2-dimethyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 54756792 |
| Molecular Formula | C19H34O2Si |
| Molecular Weight | 322.57 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | (1R,2R,4aS,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-1,2-dimethyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalene-1-carbaldehyde |
| SMILES | C[C@@H]1C=C[C@@H]2C(O[Si](C)(C)C(C)(C)C)CCC[C@H]2[C@]1(C)C=O |
| InChI | InChI=1S/C19H34O2Si/c1-14-11-12-15-16(19(14,5)13-20)9-8-10-17(15)21-22(6,7)18(2,3)4/h11-17H,8-10H2,1-7H3/t14-,15+,16-,17?,19-/m1/s1 |
| InChIKey | WQWHWZWFTOAUBP-WSWMKRCMSA-N |
| XLogP | 5.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.57 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|