C39H55NO4 — CID 54757283
(2S,4aS,6aR,6aS,6bR,8aR,12aS,14bR)-N-[2-(4-methoxyphenyl)ethyl]-2,4a,6a,6b,9,9,12a-heptamethyl-10,13-dioxo-1,3,4,5,6,6a,7,8,8a,11,12,14b-dodecahydropicene-2-carboxamide (PubChem CID 54757283) has the molecular formula C39H55NO4 and a molecular weight of 601.87 g/mol. Its IUPAC name is (2S,4aS,6aR,6aS,6bR,8aR,12aS,14bR)-N-[2-(4-methoxyphenyl)ethyl]-2,4a,6a,6b,9,9,12a-heptamethyl-10,13-dioxo-1,3,4,5,6,6a,7,8,8a,11,12,14b-dodecahydropicene-2-carboxamide.
| Compound Name | (2S,4aS,6aR,6aS,6bR,8aR,12aS,14bR)-N-[2-(4-methoxyphenyl)ethyl]-2,4a,6a,6b,9,9,12a-heptamethyl-10,13-dioxo-1,3,4,5,6,6a,7,8,8a,11,12,14b-dodecahydropicene-2-carboxamide |
|---|---|
| PubChem CID | 54757283 |
| Molecular Formula | C39H55NO4 |
| Molecular Weight | 601.87 g/mol |
| Exact Mass | 601.41 |
| IUPAC Name | (2S,4aS,6aR,6aS,6bR,8aR,12aS,14bR)-N-[2-(4-methoxyphenyl)ethyl]-2,4a,6a,6b,9,9,12a-heptamethyl-10,13-dioxo-1,3,4,5,6,6a,7,8,8a,11,12,14b-dodecahydropicene-2-carboxamide |
| SMILES | COc1ccc(CCNC(=O)[C@@]2(C)CC[C@]3(C)CC[C@]4(C)C(=CC(=O)[C@@H]5[C@@]6(C)CCC(=O)C(C)(C)[C@@H]6CC[C@]54C)[C@@H]3C2)cc1 |
| InChI | InChI=1S/C39H55NO4/c1-34(2)30-13-17-39(7)32(37(30,5)16-14-31(34)42)29(41)23-27-28-24-36(4,19-18-35(28,3)20-21-38(27,39)6)33(43)40-22-15-25-9-11-26(44-8)12-10-25/h9-12,23,28,30,32H,13-22,24H2,1-8H3,(H,40,43)/t28-,30-,32+,35+,36-,37-,38+,39+/m0/s1 |
| InChIKey | UQYNCIWNIXEHEX-BDDMGLRVSA-N |
| XLogP | 7.90 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.87 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |