About 5-[(3S)-3-phenoxypyrrolidin-1-yl]-2,2-diphenylpentanamide
5-[(3S)-3-phenoxypyrrolidin-1-yl]-2,2-diphenylpentanamide (PubChem CID 54757332) has the molecular formula C27H30N2O2
and a molecular weight of 414.55 g/mol. Its IUPAC name is 5-[(3S)-3-phenoxypyrrolidin-1-yl]-2,2-diphenylpentanamide.
Molecular Properties
| Compound Name | 5-[(3S)-3-phenoxypyrrolidin-1-yl]-2,2-diphenylpentanamide |
| PubChem CID | 54757332 |
| Molecular Formula | C27H30N2O2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 5-[(3S)-3-phenoxypyrrolidin-1-yl]-2,2-diphenylpentanamide |
| SMILES | NC(=O)C(CCCN1CC[C@H](Oc2ccccc2)C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H30N2O2/c28-26(30)27(22-11-4-1-5-12-22,23-13-6-2-7-14-23)18-10-19-29-20-17-25(21-29)31-24-15-8-3-9-16-24/h1-9,11-16,25H,10,17-21H2,(H2,28,30)/t25-/m0/s1 |
| InChIKey | XKGBDMVXPVMRSW-VWLOTQADSA-N |
| XLogP | 4.39 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[(3S)-3-phenoxypyrrolidin-1-yl]-2,2-diphenylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3S)-3-phenoxypyrrolidin-1-yl]-2,2-diphenylpentanamide?
The IUPAC name of 5-[(3S)-3-phenoxypyrrolidin-1-yl]-2,2-diphenylpentanamide (CID 54757332) is 5-[(3S)-3-phenoxypyrrolidin-1-yl]-2,2-diphenylpentanamide.
What is the SMILES notation for 5-[(3S)-3-phenoxypyrrolidin-1-yl]-2,2-diphenylpentanamide?
The canonical SMILES for 5-[(3S)-3-phenoxypyrrolidin-1-yl]-2,2-diphenylpentanamide is NC(=O)C(CCCN1CC[C@H](Oc2ccccc2)C1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 5-[(3S)-3-phenoxypyrrolidin-1-yl]-2,2-diphenylpentanamide?
The InChIKey is XKGBDMVXPVMRSW-VWLOTQADSA-N. The full InChI is InChI=1S/C27H30N2O2/c28-26(30)27(22-11-4-1-5-12-22,23-13-6-2-7-14-23)18-10-19-29-20-17-25(21-29)31-24-15-8-3-9-16-24/h1-9,11-16,25H,10,17-21H2,(H2,28,30)/t25-/m0/s1.
What are the key properties of 5-[(3S)-3-phenoxypyrrolidin-1-yl]-2,2-diphenylpentanamide?
5-[(3S)-3-phenoxypyrrolidin-1-yl]-2,2-diphenylpentanamide has a molecular weight of 414.55 g/mol, XLogP of 4.39, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3S)-3-phenoxypyrrolidin-1-yl]-2,2-diphenylpentanamide is sourced from PubChem (CID 54757332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).