C19H24O7 — CID 54757367
(1S,3R,7S,9R,12S,13R,15R)-13-hydroxy-7-(hydroxymethyl)-3,12-dimethyl-13-prop-1-en-2-yl-10,14,16-trioxatetracyclo[7.5.1.13,6.012,15]hexadec-5-ene-4,11-dione (PubChem CID 54757367) has the molecular formula C19H24O7 and a molecular weight of 364.39 g/mol. Its IUPAC name is (1S,3R,7S,9R,12S,13R,15R)-13-hydroxy-7-(hydroxymethyl)-3,12-dimethyl-13-prop-1-en-2-yl-10,14,16-trioxatetracyclo[7.5.1.13,6.012,15]hexadec-5-ene-4,11-dione.
| Compound Name | (1S,3R,7S,9R,12S,13R,15R)-13-hydroxy-7-(hydroxymethyl)-3,12-dimethyl-13-prop-1-en-2-yl-10,14,16-trioxatetracyclo[7.5.1.13,6.012,15]hexadec-5-ene-4,11-dione |
|---|---|
| PubChem CID | 54757367 |
| Molecular Formula | C19H24O7 |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | (1S,3R,7S,9R,12S,13R,15R)-13-hydroxy-7-(hydroxymethyl)-3,12-dimethyl-13-prop-1-en-2-yl-10,14,16-trioxatetracyclo[7.5.1.13,6.012,15]hexadec-5-ene-4,11-dione |
| SMILES | C=C(C)[C@@]1(O)O[C@H]2C[C@@]3(C)OC(=CC3=O)[C@H](CO)C[C@H]3OC(=O)[C@@]1(C)[C@H]23 |
| InChI | InChI=1S/C19H24O7/c1-9(2)19(23)18(4)15-12(24-16(18)22)5-10(8-20)11-6-14(21)17(3,25-11)7-13(15)26-19/h6,10,12-13,15,20,23H,1,5,7-8H2,2-4H3/t10-,12+,13-,15-,17+,18+,19+/m0/s1 |
| InChIKey | BOYDMKWQYUSADR-UIQCIZMRSA-N |
| XLogP | 0.84 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|