C18H17FN4O2 — CID 54757398
2-[(5-fluoro-8-oxo-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaen-10-yl)amino]-N,N-dimethylethanamine oxide (PubChem CID 54757398) has the molecular formula C18H17FN4O2 and a molecular weight of 340.36 g/mol. Its IUPAC name is 2-[(5-fluoro-8-oxo-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaen-10-yl)amino]-N,N-dimethylethanamine oxide.
| Compound Name | 2-[(5-fluoro-8-oxo-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaen-10-yl)amino]-N,N-dimethylethanamine oxide |
|---|---|
| PubChem CID | 54757398 |
| Molecular Formula | C18H17FN4O2 |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 2-[(5-fluoro-8-oxo-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaen-10-yl)amino]-N,N-dimethylethanamine oxide |
| SMILES | C[N+](C)([O-])CCNc1ccc2ncn3c4ccc(F)cc4c(=O)c1c23 |
| InChI | InChI=1S/C18H17FN4O2/c1-23(2,25)8-7-20-13-4-5-14-17-16(13)18(24)12-9-11(19)3-6-15(12)22(17)10-21-14/h3-6,9-10,20H,7-8H2,1-2H3 |
| InChIKey | INRNHVHRUAPPLT-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 69.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|