About 5-bromo-N-[(1S,2S)-2-methoxycyclohex-3-en-1-yl]pyridin-2-amine
5-bromo-N-[(1S,2S)-2-methoxycyclohex-3-en-1-yl]pyridin-2-amine (PubChem CID 54757429) has the molecular formula C12H15BrN2O
and a molecular weight of 283.17 g/mol. Its IUPAC name is 5-bromo-N-[(1S,2S)-2-methoxycyclohex-3-en-1-yl]pyridin-2-amine.
Molecular Properties
| Compound Name | 5-bromo-N-[(1S,2S)-2-methoxycyclohex-3-en-1-yl]pyridin-2-amine |
| PubChem CID | 54757429 |
| Molecular Formula | C12H15BrN2O |
| Molecular Weight | 283.17 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 5-bromo-N-[(1S,2S)-2-methoxycyclohex-3-en-1-yl]pyridin-2-amine |
| SMILES | CO[C@H]1C=CCC[C@@H]1Nc1ccc(Br)cn1 |
| InChI | InChI=1S/C12H15BrN2O/c1-16-11-5-3-2-4-10(11)15-12-7-6-9(13)8-14-12/h3,5-8,10-11H,2,4H2,1H3,(H,14,15)/t10-,11-/m0/s1 |
| InChIKey | IMEJAIAJJIOSIE-QWRGUYRKSA-N |
| XLogP | 2.99 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.17 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-N-[(1S,2S)-2-methoxycyclohex-3-en-1-yl]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-[(1S,2S)-2-methoxycyclohex-3-en-1-yl]pyridin-2-amine?
The IUPAC name of 5-bromo-N-[(1S,2S)-2-methoxycyclohex-3-en-1-yl]pyridin-2-amine (CID 54757429) is 5-bromo-N-[(1S,2S)-2-methoxycyclohex-3-en-1-yl]pyridin-2-amine.
What is the SMILES notation for 5-bromo-N-[(1S,2S)-2-methoxycyclohex-3-en-1-yl]pyridin-2-amine?
The canonical SMILES for 5-bromo-N-[(1S,2S)-2-methoxycyclohex-3-en-1-yl]pyridin-2-amine is CO[C@H]1C=CCC[C@@H]1Nc1ccc(Br)cn1.
What is the InChIKey of 5-bromo-N-[(1S,2S)-2-methoxycyclohex-3-en-1-yl]pyridin-2-amine?
The InChIKey is IMEJAIAJJIOSIE-QWRGUYRKSA-N. The full InChI is InChI=1S/C12H15BrN2O/c1-16-11-5-3-2-4-10(11)15-12-7-6-9(13)8-14-12/h3,5-8,10-11H,2,4H2,1H3,(H,14,15)/t10-,11-/m0/s1.
What are the key properties of 5-bromo-N-[(1S,2S)-2-methoxycyclohex-3-en-1-yl]pyridin-2-amine?
5-bromo-N-[(1S,2S)-2-methoxycyclohex-3-en-1-yl]pyridin-2-amine has a molecular weight of 283.17 g/mol, XLogP of 2.99, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-[(1S,2S)-2-methoxycyclohex-3-en-1-yl]pyridin-2-amine is sourced from PubChem (CID 54757429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).