C22H18Cl2N2 — CID 54757710
6-chloro-3-[(3-chlorophenyl)methyl]-2-methyl-4-phenyl-4H-quinazoline (PubChem CID 54757710) has the molecular formula C22H18Cl2N2 and a molecular weight of 381.31 g/mol. Its IUPAC name is 6-chloro-3-[(3-chlorophenyl)methyl]-2-methyl-4-phenyl-4H-quinazoline.
| Compound Name | 6-chloro-3-[(3-chlorophenyl)methyl]-2-methyl-4-phenyl-4H-quinazoline |
|---|---|
| PubChem CID | 54757710 |
| Molecular Formula | C22H18Cl2N2 |
| Molecular Weight | 381.31 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 6-chloro-3-[(3-chlorophenyl)methyl]-2-methyl-4-phenyl-4H-quinazoline |
| SMILES | CC1=Nc2ccc(Cl)cc2C(c2ccccc2)N1Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C22H18Cl2N2/c1-15-25-21-11-10-19(24)13-20(21)22(17-7-3-2-4-8-17)26(15)14-16-6-5-9-18(23)12-16/h2-13,22H,14H2,1H3 |
| InChIKey | WBHNYGBOSGGJFP-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.31 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |