C18H15F3N6O5 — CID 54757720
(6S)-2-nitro-6-[2-[5-[6-(trifluoromethyl)-3-pyridinyl]pyrimidin-2-yl]oxyethoxy]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine (PubChem CID 54757720) has the molecular formula C18H15F3N6O5 and a molecular weight of 452.35 g/mol. Its IUPAC name is (6S)-2-nitro-6-[2-[5-[6-(trifluoromethyl)-3-pyridinyl]pyrimidin-2-yl]oxyethoxy]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine.
| Compound Name | (6S)-2-nitro-6-[2-[5-[6-(trifluoromethyl)-3-pyridinyl]pyrimidin-2-yl]oxyethoxy]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine |
|---|---|
| PubChem CID | 54757720 |
| Molecular Formula | C18H15F3N6O5 |
| Molecular Weight | 452.35 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | (6S)-2-nitro-6-[2-[5-[6-(trifluoromethyl)-3-pyridinyl]pyrimidin-2-yl]oxyethoxy]-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazine |
| SMILES | O=[N+]([O-])c1cn2c(n1)OC[C@@H](OCCOc1ncc(-c3ccc(C(F)(F)F)nc3)cn1)C2 |
| InChI | InChI=1S/C18H15F3N6O5/c19-18(20,21)14-2-1-11(5-22-14)12-6-23-16(24-7-12)31-4-3-30-13-8-26-9-15(27(28)29)25-17(26)32-10-13/h1-2,5-7,9,13H,3-4,8,10H2/t13-/m0/s1 |
| InChIKey | NRXIMYZYYGBBII-ZDUSSCGKSA-N |
| XLogP | 2.52 |
| TPSA | 127.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.35 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|