About CID 5475782
CID 5475782 (PubChem CID 5475782) has the molecular formula C4H7
and a molecular weight of 55.10 g/mol.
Molecular Properties
| Compound Name | CID 5475782 |
| PubChem CID | 5475782 |
| Molecular Formula | C4H7 |
| Molecular Weight | 55.10 g/mol |
| Exact Mass | 55.05 |
| IUPAC Name | — |
| SMILES | [CH]=C(C)C |
| InChI | InChI=1S/C4H7/c1-4(2)3/h1H,2-3H3 |
| InChIKey | ZVYGPDVHHRTJCD-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 55.10 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 5475782 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 5475782?
The IUPAC name of CID 5475782 (CID 5475782) is not available.
What is the SMILES notation for CID 5475782?
The canonical SMILES for CID 5475782 is [CH]=C(C)C.
What is the InChIKey of CID 5475782?
The InChIKey is ZVYGPDVHHRTJCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7/c1-4(2)3/h1H,2-3H3.
What are the key properties of CID 5475782?
CID 5475782 has a molecular weight of 55.10 g/mol, XLogP of 1.39, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 5475782 is sourced from PubChem (CID 5475782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).