C23H46N6O4 — CID 54757820
tert-butyl N-[3-(1-aminoethylideneamino)propyl]-N-[3-[3-(1-aminoethylideneamino)propyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propyl]carbamate (PubChem CID 54757820) has the molecular formula C23H46N6O4 and a molecular weight of 470.66 g/mol. Its IUPAC name is tert-butyl N-[3-(1-aminoethylideneamino)propyl]-N-[3-[3-(1-aminoethylideneamino)propyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-(1-aminoethylideneamino)propyl]-N-[3-[3-(1-aminoethylideneamino)propyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 54757820 |
| Molecular Formula | C23H46N6O4 |
| Molecular Weight | 470.66 g/mol |
| Exact Mass | 470.36 |
| IUPAC Name | tert-butyl N-[3-(1-aminoethylideneamino)propyl]-N-[3-[3-(1-aminoethylideneamino)propyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propyl]carbamate |
| SMILES | C/C(N)=N\CCCN(CCCN(CCC/N=C(\C)N)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H46N6O4/c1-18(24)26-12-9-14-28(20(30)32-22(3,4)5)16-11-17-29(15-10-13-27-19(2)25)21(31)33-23(6,7)8/h9-17H2,1-8H3,(H2,24,26)(H2,25,27) |
| InChIKey | VKGSHJVXHZJWGS-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 135.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.66 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|