C18H23O4P — CID 54758130
4-diethoxyphosphoryl-4-naphthalen-1-ylbutanal (PubChem CID 54758130) has the molecular formula C18H23O4P and a molecular weight of 334.35 g/mol. Its IUPAC name is 4-diethoxyphosphoryl-4-naphthalen-1-ylbutanal.
| Compound Name | 4-diethoxyphosphoryl-4-naphthalen-1-ylbutanal |
|---|---|
| PubChem CID | 54758130 |
| Molecular Formula | C18H23O4P |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 4-diethoxyphosphoryl-4-naphthalen-1-ylbutanal |
| SMILES | CCOP(=O)(OCC)C(CCC=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C18H23O4P/c1-3-21-23(20,22-4-2)18(13-8-14-19)17-12-7-10-15-9-5-6-11-16(15)17/h5-7,9-12,14,18H,3-4,8,13H2,1-2H3 |
| InChIKey | AMDBJVGTPCFKSL-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|